C11H18O5 — CID 102039785
[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] ethyl carbonate (PubChem CID 102039785) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] ethyl carbonate.
| Compound Name | [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 102039785 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H18O5/c1-4-13-10(12)14-7-5-6-9-8-15-11(2,3)16-9/h5-6,9H,4,7-8H2,1-3H3/b6-5+/t9-/m0/s1 |
| InChIKey | SWNCMYFIVSFWGQ-CYNONHLPSA-N |
| XLogP | 1.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|