C12H18O6 — CID 101109016
[(E)-1-acetyloxy-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] acetate (PubChem CID 101109016) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is [(E)-1-acetyloxy-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] acetate.
| Compound Name | [(E)-1-acetyloxy-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 101109016 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | [(E)-1-acetyloxy-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] acetate |
| SMILES | CC(=O)OC(/C=C/[C@H]1COC(C)(C)O1)OC(C)=O |
| InChI | InChI=1S/C12H18O6/c1-8(13)16-11(17-9(2)14)6-5-10-7-15-12(3,4)18-10/h5-6,10-11H,7H2,1-4H3/b6-5+/t10-/m0/s1 |
| InChIKey | XLVOODUQMVSYST-PORFMDCZSA-N |
| XLogP | 1.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|