C14H22Cl3NO3 — CID 15738404
2,2,2-trichloro-N-[(E,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-en-3-yl]acetamide (PubChem CID 15738404) has the molecular formula C14H22Cl3NO3 and a molecular weight of 358.69 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(E,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-en-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(E,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 15738404 |
| Molecular Formula | C14H22Cl3NO3 |
| Molecular Weight | 358.69 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2,2,2-trichloro-N-[(E,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-1-en-3-yl]acetamide |
| SMILES | CCCC[C@H](/C=C/[C@H]1COC(C)(C)O1)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H22Cl3NO3/c1-4-5-6-10(18-12(19)14(15,16)17)7-8-11-9-20-13(2,3)21-11/h7-8,10-11H,4-6,9H2,1-3H3,(H,18,19)/b8-7+/t10-,11+/m1/s1 |
| InChIKey | GZVSTOGMJIOYRA-SFEFJYQLSA-N |
| XLogP | 3.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|