C11H15NO3 — CID 45097166
(E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methylidenepent-4-enenitrile (PubChem CID 45097166) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is (E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methylidenepent-4-enenitrile.
| Compound Name | (E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methylidenepent-4-enenitrile |
|---|---|
| PubChem CID | 45097166 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methylidenepent-4-enenitrile |
| SMILES | C=C(C#N)C(O)/C=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H15NO3/c1-8(6-12)10(13)5-4-9-7-14-11(2,3)15-9/h4-5,9-10,13H,1,7H2,2-3H3/b5-4+/t9-,10?/m0/s1 |
| InChIKey | RUVFLXOEQAUCML-WTPAVHSTSA-N |
| XLogP | 1.13 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|