C19H25N5 — CID 102040151
2,6-bis(1-butylpyrazol-3-yl)pyridine (PubChem CID 102040151) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2,6-bis(1-butylpyrazol-3-yl)pyridine.
| Compound Name | 2,6-bis(1-butylpyrazol-3-yl)pyridine |
|---|---|
| PubChem CID | 102040151 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2,6-bis(1-butylpyrazol-3-yl)pyridine |
| SMILES | CCCCn1ccc(-c2cccc(-c3ccn(CCCC)n3)n2)n1 |
| InChI | InChI=1S/C19H25N5/c1-3-5-12-23-14-10-18(21-23)16-8-7-9-17(20-16)19-11-15-24(22-19)13-6-4-2/h7-11,14-15H,3-6,12-13H2,1-2H3 |
| InChIKey | MBOKGQLVCCTTKW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |