C60H93N3O6 — CID 102041905
2-[5,9-bis(4-decoxy-7-oxocyclohepta-1,3,5-trien-1-yl)-1,5,9-triazacyclododec-1-yl]-5-decoxycyclohepta-2,4,6-trien-1-one (PubChem CID 102041905) has the molecular formula C60H93N3O6 and a molecular weight of 952.42 g/mol. Its IUPAC name is 2-[5,9-bis(4-decoxy-7-oxocyclohepta-1,3,5-trien-1-yl)-1,5,9-triazacyclododec-1-yl]-5-decoxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-[5,9-bis(4-decoxy-7-oxocyclohepta-1,3,5-trien-1-yl)-1,5,9-triazacyclododec-1-yl]-5-decoxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 102041905 |
| Molecular Formula | C60H93N3O6 |
| Molecular Weight | 952.42 g/mol |
| Exact Mass | 951.71 |
| IUPAC Name | 2-[5,9-bis(4-decoxy-7-oxocyclohepta-1,3,5-trien-1-yl)-1,5,9-triazacyclododec-1-yl]-5-decoxycyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCCCCCCCOc1ccc(N2CCCN(c3ccc(OCCCCCCCCCC)ccc3=O)CCCN(c3ccc(OCCCCCCCCCC)ccc3=O)CCC2)c(=O)cc1 |
| InChI | InChI=1S/C60H93N3O6/c1-4-7-10-13-16-19-22-25-49-67-52-31-37-55(58(64)40-34-52)61-43-28-45-62(56-38-32-53(35-41-59(56)65)68-50-26-23-20-17-14-11-8-5-2)47-30-48-63(46-29-44-61)57-39-33-54(36-42-60(57)66)69-51-27-24-21-18-15-12-9-6-3/h31-42H,4-30,43-51H2,1-3H3 |
| InChIKey | MZSPSWCFGFCJTE-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.42 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|