C36H27NO2 — CID 102041983
(1S,4R)-1,3,4,5,7-pentakis-phenyl-1,4-dihydrofuro[3,4-d]oxazine (PubChem CID 102041983) has the molecular formula C36H27NO2 and a molecular weight of 505.62 g/mol. Its IUPAC name is (1S,4R)-1,3,4,5,7-pentakis-phenyl-1,4-dihydrofuro[3,4-d]oxazine.
| Compound Name | (1S,4R)-1,3,4,5,7-pentakis-phenyl-1,4-dihydrofuro[3,4-d]oxazine |
|---|---|
| PubChem CID | 102041983 |
| Molecular Formula | C36H27NO2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | (1S,4R)-1,3,4,5,7-pentakis-phenyl-1,4-dihydrofuro[3,4-d]oxazine |
| SMILES | c1ccc(-c2oc(-c3ccccc3)c3c2[C@H](c2ccccc2)ON(c2ccccc2)[C@@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C36H27NO2/c1-6-16-26(17-7-1)33-31-32(35(28-20-10-3-11-21-28)38-34(31)27-18-8-2-9-19-27)36(29-22-12-4-13-23-29)39-37(33)30-24-14-5-15-25-30/h1-25,33,36H/t33-,36+/m1/s1 |
| InChIKey | NMOAPHDPDRVKNH-ILFWFZRHSA-N |
| XLogP | 9.24 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |