C76H64N4O4 — CID 139094838
(5S)-2-(4-methoxyphenyl)-4,5,6,8-tetraphenyl-3,5-dihydro-1H-furo[3,4-e][1,3]diazepine (PubChem CID 139094838) has the molecular formula C76H64N4O4 and a molecular weight of 1097.37 g/mol. Its IUPAC name is (5S)-2-(4-methoxyphenyl)-4,5,6,8-tetraphenyl-3,5-dihydro-1H-furo[3,4-e][1,3]diazepine.
| Compound Name | (5S)-2-(4-methoxyphenyl)-4,5,6,8-tetraphenyl-3,5-dihydro-1H-furo[3,4-e][1,3]diazepine |
|---|---|
| PubChem CID | 139094838 |
| Molecular Formula | C76H64N4O4 |
| Molecular Weight | 1097.37 g/mol |
| Exact Mass | 1096.49 |
| IUPAC Name | (5S)-2-(4-methoxyphenyl)-4,5,6,8-tetraphenyl-3,5-dihydro-1H-furo[3,4-e][1,3]diazepine |
| SMILES | COc1ccc(N2Cc3c(-c4ccccc4)oc(-c4ccccc4)c3[C@H](c3ccccc3)N(c3ccccc3)C2)cc1.COc1ccc(N2Cc3c(-c4ccccc4)oc(-c4ccccc4)c3[C@H](c3ccccc3)N(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/2C38H32N2O2/c2*1-41-33-24-22-31(23-25-33)39-26-34-35(36(28-14-6-2-7-15-28)40(27-39)32-20-12-5-13-21-32)38(30-18-10-4-11-19-30)42-37(34)29-16-8-3-9-17-29/h2*2-25,36H,26-27H2,1H3/t2*36-/m00/s1 |
| InChIKey | FNLGIRRZSHAZAR-DADSMOBCSA-N |
| XLogP | 18.39 |
| TPSA | 57.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.37 |
| LogP ≤ 5 | 18.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|