C26H28N2O3 — CID 155934165
1,3-bis(4-methoxyphenyl)-5-(phenylmethoxymethylidene)-1,3-diazinane (PubChem CID 155934165) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-5-(phenylmethoxymethylidene)-1,3-diazinane.
| Compound Name | 1,3-bis(4-methoxyphenyl)-5-(phenylmethoxymethylidene)-1,3-diazinane |
|---|---|
| PubChem CID | 155934165 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-5-(phenylmethoxymethylidene)-1,3-diazinane |
| SMILES | COc1ccc(N2CC(=COCc3ccccc3)CN(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C26H28N2O3/c1-29-25-12-8-23(9-13-25)27-16-22(19-31-18-21-6-4-3-5-7-21)17-28(20-27)24-10-14-26(30-2)15-11-24/h3-15,19H,16-18,20H2,1-2H3 |
| InChIKey | FNYUDEVFIFHIOV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|