C34H37N3O4S — CID 177385510
N-benzyl-N-[(Z)-[1,3-bis(4-methoxyphenyl)-4-methyl-1,3-diazinan-5-ylidene]methyl]-4-methylbenzenesulfonamide (PubChem CID 177385510) has the molecular formula C34H37N3O4S and a molecular weight of 583.75 g/mol. Its IUPAC name is N-benzyl-N-[(Z)-[1,3-bis(4-methoxyphenyl)-4-methyl-1,3-diazinan-5-ylidene]methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(Z)-[1,3-bis(4-methoxyphenyl)-4-methyl-1,3-diazinan-5-ylidene]methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177385510 |
| Molecular Formula | C34H37N3O4S |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | N-benzyl-N-[(Z)-[1,3-bis(4-methoxyphenyl)-4-methyl-1,3-diazinan-5-ylidene]methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(N2C/C(=C/N(Cc3ccccc3)S(=O)(=O)c3ccc(C)cc3)C(C)N(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C34H37N3O4S/c1-26-10-20-34(21-11-26)42(38,39)36(22-28-8-6-5-7-9-28)24-29-23-35(30-12-16-32(40-3)17-13-30)25-37(27(29)2)31-14-18-33(41-4)19-15-31/h5-21,24,27H,22-23,25H2,1-4H3/b29-24- |
| InChIKey | ROTIXAHNUCWOSD-OLFWJLLRSA-N |
| XLogP | 6.46 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|