C39H33NO3S — CID 154720580
N-benzyl-N-[(E)-1-(4-methoxyphenyl)-2-naphthalen-1-yl-2-phenylethenyl]-4-methylbenzenesulfonamide (PubChem CID 154720580) has the molecular formula C39H33NO3S and a molecular weight of 595.76 g/mol. Its IUPAC name is N-benzyl-N-[(E)-1-(4-methoxyphenyl)-2-naphthalen-1-yl-2-phenylethenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(E)-1-(4-methoxyphenyl)-2-naphthalen-1-yl-2-phenylethenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154720580 |
| Molecular Formula | C39H33NO3S |
| Molecular Weight | 595.76 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | N-benzyl-N-[(E)-1-(4-methoxyphenyl)-2-naphthalen-1-yl-2-phenylethenyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(/C(=C(/c2ccccc2)c2cccc3ccccc23)N(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C39H33NO3S/c1-29-20-26-35(27-21-29)44(41,42)40(28-30-12-5-3-6-13-30)39(33-22-24-34(43-2)25-23-33)38(32-15-7-4-8-16-32)37-19-11-17-31-14-9-10-18-36(31)37/h3-27H,28H2,1-2H3/b39-38+ |
| InChIKey | OSUQFFFZDQVBCY-YMZYAJTMSA-N |
| XLogP | 8.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.76 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|