C31H29NO6S — CID 177385033
[(Z)-1-[benzyl-(4-methylphenyl)sulfonylamino]-2-phenylethenyl] 3,5-dimethoxybenzoate (PubChem CID 177385033) has the molecular formula C31H29NO6S and a molecular weight of 543.64 g/mol. Its IUPAC name is [(Z)-1-[benzyl-(4-methylphenyl)sulfonylamino]-2-phenylethenyl] 3,5-dimethoxybenzoate.
| Compound Name | [(Z)-1-[benzyl-(4-methylphenyl)sulfonylamino]-2-phenylethenyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 177385033 |
| Molecular Formula | C31H29NO6S |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | [(Z)-1-[benzyl-(4-methylphenyl)sulfonylamino]-2-phenylethenyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)O/C(=C\c2ccccc2)N(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C31H29NO6S/c1-23-14-16-29(17-15-23)39(34,35)32(22-25-12-8-5-9-13-25)30(18-24-10-6-4-7-11-24)38-31(33)26-19-27(36-2)21-28(20-26)37-3/h4-21H,22H2,1-3H3/b30-18- |
| InChIKey | NTARQPQTJRAQDS-YKQZZPSBSA-N |
| XLogP | 6.06 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|