C36H30N2O2S — CID 154720582
N-benzyl-N-[(E)-1-(3-cyanophenyl)-2-(4-methylphenyl)-2-phenylethenyl]-4-methylbenzenesulfonamide (PubChem CID 154720582) has the molecular formula C36H30N2O2S and a molecular weight of 554.72 g/mol. Its IUPAC name is N-benzyl-N-[(E)-1-(3-cyanophenyl)-2-(4-methylphenyl)-2-phenylethenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(E)-1-(3-cyanophenyl)-2-(4-methylphenyl)-2-phenylethenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 154720582 |
| Molecular Formula | C36H30N2O2S |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | N-benzyl-N-[(E)-1-(3-cyanophenyl)-2-(4-methylphenyl)-2-phenylethenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(/C(=C(\c2cccc(C#N)c2)N(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30N2O2S/c1-27-16-20-32(21-17-27)35(31-13-7-4-8-14-31)36(33-15-9-12-30(24-33)25-37)38(26-29-10-5-3-6-11-29)41(39,40)34-22-18-28(2)19-23-34/h3-24H,26H2,1-2H3/b36-35+ |
| InChIKey | YEDNSZYVCRLRBY-ULDVOPSXSA-N |
| XLogP | 7.98 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|