C10H15Cl3O2 — CID 102042632
[(Z)-oct-1-enyl] 2,2,2-trichloroacetate (PubChem CID 102042632) has the molecular formula C10H15Cl3O2 and a molecular weight of 273.59 g/mol. Its IUPAC name is [(Z)-oct-1-enyl] 2,2,2-trichloroacetate.
| Compound Name | [(Z)-oct-1-enyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 102042632 |
| Molecular Formula | C10H15Cl3O2 |
| Molecular Weight | 273.59 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | [(Z)-oct-1-enyl] 2,2,2-trichloroacetate |
| SMILES | CCCCCC/C=C\OC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H15Cl3O2/c1-2-3-4-5-6-7-8-15-9(14)10(11,12)13/h7-8H,2-6H2,1H3/b8-7- |
| InChIKey | FMHAZLDPPDQSQS-FPLPWBNLSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|