About dec-1-enyl 2-sulfanylacetate
dec-1-enyl 2-sulfanylacetate (PubChem CID 175348578) has the molecular formula C12H22O2S
and a molecular weight of 230.37 g/mol. Its IUPAC name is dec-1-enyl 2-sulfanylacetate.
Molecular Properties
| Compound Name | dec-1-enyl 2-sulfanylacetate |
| PubChem CID | 175348578 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | dec-1-enyl 2-sulfanylacetate |
| SMILES | CCCCCCCCC=COC(=O)CS |
| InChI | InChI=1S/C12H22O2S/c1-2-3-4-5-6-7-8-9-10-14-12(13)11-15/h9-10,15H,2-8,11H2,1H3 |
| InChIKey | MIHZSPVJUXHHFM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dec-1-enyl 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-1-enyl 2-sulfanylacetate?
The IUPAC name of dec-1-enyl 2-sulfanylacetate (CID 175348578) is dec-1-enyl 2-sulfanylacetate.
What is the SMILES notation for dec-1-enyl 2-sulfanylacetate?
The canonical SMILES for dec-1-enyl 2-sulfanylacetate is CCCCCCCCC=COC(=O)CS.
What is the InChIKey of dec-1-enyl 2-sulfanylacetate?
The InChIKey is MIHZSPVJUXHHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2S/c1-2-3-4-5-6-7-8-9-10-14-12(13)11-15/h9-10,15H,2-8,11H2,1H3.
What are the key properties of dec-1-enyl 2-sulfanylacetate?
dec-1-enyl 2-sulfanylacetate has a molecular weight of 230.37 g/mol, XLogP of 3.72, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dec-1-enyl 2-sulfanylacetate is sourced from PubChem (CID 175348578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).