C21H21ClF3NS — CID 102042717
(Z)-8-chloro-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-N-phenyloct-3-en-2-imine (PubChem CID 102042717) has the molecular formula C21H21ClF3NS and a molecular weight of 411.92 g/mol. Its IUPAC name is (Z)-8-chloro-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-N-phenyloct-3-en-2-imine.
| Compound Name | (Z)-8-chloro-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-N-phenyloct-3-en-2-imine |
|---|---|
| PubChem CID | 102042717 |
| Molecular Formula | C21H21ClF3NS |
| Molecular Weight | 411.92 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (Z)-8-chloro-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-N-phenyloct-3-en-2-imine |
| SMILES | Cc1ccc(S/C(=C\C(=N\c2ccccc2)C(F)(F)F)CCCCCl)cc1 |
| InChI | InChI=1S/C21H21ClF3NS/c1-16-10-12-18(13-11-16)27-19(9-5-6-14-22)15-20(21(23,24)25)26-17-7-3-2-4-8-17/h2-4,7-8,10-13,15H,5-6,9,14H2,1H3/b19-15-,26-20- |
| InChIKey | DVFANHNYZYKHEF-ILWHNECUSA-N |
| XLogP | 7.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.92 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|