C24H26F3NO2S — CID 102042719
(Z)-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-6-(oxan-2-yloxy)-N-phenylhex-3-en-2-imine (PubChem CID 102042719) has the molecular formula C24H26F3NO2S and a molecular weight of 449.54 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-6-(oxan-2-yloxy)-N-phenylhex-3-en-2-imine.
| Compound Name | (Z)-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-6-(oxan-2-yloxy)-N-phenylhex-3-en-2-imine |
|---|---|
| PubChem CID | 102042719 |
| Molecular Formula | C24H26F3NO2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-6-(oxan-2-yloxy)-N-phenylhex-3-en-2-imine |
| SMILES | Cc1ccc(S/C(=C\C(=N\c2ccccc2)C(F)(F)F)CCOC2CCCCO2)cc1 |
| InChI | InChI=1S/C24H26F3NO2S/c1-18-10-12-20(13-11-18)31-21(14-16-30-23-9-5-6-15-29-23)17-22(24(25,26)27)28-19-7-3-2-4-8-19/h2-4,7-8,10-13,17,23H,5-6,9,14-16H2,1H3/b21-17-,28-22- |
| InChIKey | ZEMHFLFOWALYOM-KJMKYVGQSA-N |
| XLogP | 7.24 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|