C22H22F3NO2S — CID 102042718
methyl (Z)-8,8,8-trifluoro-5-(4-methylphenyl)sulfanyl-7-phenyliminooct-5-enoate (PubChem CID 102042718) has the molecular formula C22H22F3NO2S and a molecular weight of 421.48 g/mol. Its IUPAC name is methyl (Z)-8,8,8-trifluoro-5-(4-methylphenyl)sulfanyl-7-phenyliminooct-5-enoate.
| Compound Name | methyl (Z)-8,8,8-trifluoro-5-(4-methylphenyl)sulfanyl-7-phenyliminooct-5-enoate |
|---|---|
| PubChem CID | 102042718 |
| Molecular Formula | C22H22F3NO2S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | methyl (Z)-8,8,8-trifluoro-5-(4-methylphenyl)sulfanyl-7-phenyliminooct-5-enoate |
| SMILES | COC(=O)CCC/C(=C/C(=N/c1ccccc1)C(F)(F)F)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C22H22F3NO2S/c1-16-11-13-18(14-12-16)29-19(9-6-10-21(27)28-2)15-20(22(23,24)25)26-17-7-4-3-5-8-17/h3-5,7-8,11-15H,6,9-10H2,1-2H3/b19-15-,26-20- |
| InChIKey | WNXPQPLCLKREKA-ILWHNECUSA-N |
| XLogP | 6.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|