C26H22F3NO2S — CID 139037792
ethyl (2E)-4,4,4-trifluoro-2-[(4-methylphenyl)sulfanyl-phenylmethylidene]-3-phenyliminobutanoate (PubChem CID 139037792) has the molecular formula C26H22F3NO2S and a molecular weight of 469.53 g/mol. Its IUPAC name is ethyl (2E)-4,4,4-trifluoro-2-[(4-methylphenyl)sulfanyl-phenylmethylidene]-3-phenyliminobutanoate.
| Compound Name | ethyl (2E)-4,4,4-trifluoro-2-[(4-methylphenyl)sulfanyl-phenylmethylidene]-3-phenyliminobutanoate |
|---|---|
| PubChem CID | 139037792 |
| Molecular Formula | C26H22F3NO2S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | ethyl (2E)-4,4,4-trifluoro-2-[(4-methylphenyl)sulfanyl-phenylmethylidene]-3-phenyliminobutanoate |
| SMILES | CCOC(=O)C(/C(=N/c1ccccc1)C(F)(F)F)=C(/Sc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H22F3NO2S/c1-3-32-25(31)22(24(26(27,28)29)30-20-12-8-5-9-13-20)23(19-10-6-4-7-11-19)33-21-16-14-18(2)15-17-21/h4-17H,3H2,1-2H3/b23-22+,30-24- |
| InChIKey | ZNHKLKBXQJDYRM-DQYUVWCTSA-N |
| XLogP | 7.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|