C25H22F3NOS — CID 102042711
(E)-1,1,1-trifluoro-3-(methoxymethyl)-4-(4-methylphenyl)sulfanyl-N,4-diphenylbut-3-en-2-imine (PubChem CID 102042711) has the molecular formula C25H22F3NOS and a molecular weight of 441.52 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-3-(methoxymethyl)-4-(4-methylphenyl)sulfanyl-N,4-diphenylbut-3-en-2-imine.
| Compound Name | (E)-1,1,1-trifluoro-3-(methoxymethyl)-4-(4-methylphenyl)sulfanyl-N,4-diphenylbut-3-en-2-imine |
|---|---|
| PubChem CID | 102042711 |
| Molecular Formula | C25H22F3NOS |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (E)-1,1,1-trifluoro-3-(methoxymethyl)-4-(4-methylphenyl)sulfanyl-N,4-diphenylbut-3-en-2-imine |
| SMILES | COCC(/C(=N/c1ccccc1)C(F)(F)F)=C(/Sc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H22F3NOS/c1-18-13-15-21(16-14-18)31-23(19-9-5-3-6-10-19)22(17-30-2)24(25(26,27)28)29-20-11-7-4-8-12-20/h3-16H,17H2,1-2H3/b23-22-,29-24- |
| InChIKey | LCJZQQXNXYKJDW-DICIPZHFSA-N |
| XLogP | 7.48 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|