C19H19NOS — CID 139050519
(2Z)-2-benzylidene-3-butoxy-1,4-benzothiazine (PubChem CID 139050519) has the molecular formula C19H19NOS and a molecular weight of 309.43 g/mol. Its IUPAC name is (2Z)-2-benzylidene-3-butoxy-1,4-benzothiazine.
| Compound Name | (2Z)-2-benzylidene-3-butoxy-1,4-benzothiazine |
|---|---|
| PubChem CID | 139050519 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2Z)-2-benzylidene-3-butoxy-1,4-benzothiazine |
| SMILES | CCCCOC1=Nc2ccccc2S/C1=C\c1ccccc1 |
| InChI | InChI=1S/C19H19NOS/c1-2-3-13-21-19-18(14-15-9-5-4-6-10-15)22-17-12-8-7-11-16(17)20-19/h4-12,14H,2-3,13H2,1H3/b18-14- |
| InChIKey | BTEMZVGQIZVHJI-JXAWBTAJSA-N |
| XLogP | 5.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|