C20H22FNOS — CID 90896044
butan-2-yl 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidate (PubChem CID 90896044) has the molecular formula C20H22FNOS and a molecular weight of 343.47 g/mol. Its IUPAC name is butan-2-yl 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidate.
| Compound Name | butan-2-yl 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidate |
|---|---|
| PubChem CID | 90896044 |
| Molecular Formula | C20H22FNOS |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | butan-2-yl 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidate |
| SMILES | CCC(C)O/C(C=CSc1ccc(F)cc1)=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22FNOS/c1-4-16(3)23-20(22-18-9-5-15(2)6-10-18)13-14-24-19-11-7-17(21)8-12-19/h5-14,16H,4H2,1-3H3/b14-13?,22-20+ |
| InChIKey | AJIQHRRBANHTSA-LJDROAEUSA-N |
| XLogP | 6.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|