C23H21F2NOS — CID 88533740
6-[2-(2,4-difluorophenyl)sulfanylethenylidene]-3-ethoxy-N-(4-methylphenyl)cyclohex-2-en-1-imine (PubChem CID 88533740) has the molecular formula C23H21F2NOS and a molecular weight of 397.49 g/mol. Its IUPAC name is 6-[2-(2,4-difluorophenyl)sulfanylethenylidene]-3-ethoxy-N-(4-methylphenyl)cyclohex-2-en-1-imine.
| Compound Name | 6-[2-(2,4-difluorophenyl)sulfanylethenylidene]-3-ethoxy-N-(4-methylphenyl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 88533740 |
| Molecular Formula | C23H21F2NOS |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 6-[2-(2,4-difluorophenyl)sulfanylethenylidene]-3-ethoxy-N-(4-methylphenyl)cyclohex-2-en-1-imine |
| SMILES | CCOC1=C/C(=N\c2ccc(C)cc2)C(=C=CSc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C23H21F2NOS/c1-3-27-20-10-6-17(12-13-28-23-11-7-18(24)14-21(23)25)22(15-20)26-19-8-4-16(2)5-9-19/h4-5,7-9,11,13-15H,3,6,10H2,1-2H3/b26-22+ |
| InChIKey | YEIAFDKUXMKBEI-XTCLZLMSSA-N |
| XLogP | 6.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|