C20H20FNOS — CID 77439569
3-[(4-fluorophenyl)sulfanylmethylidene]-4,4-dimethyl-N-(4-methylphenyl)oxolan-2-imine (PubChem CID 77439569) has the molecular formula C20H20FNOS and a molecular weight of 341.45 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfanylmethylidene]-4,4-dimethyl-N-(4-methylphenyl)oxolan-2-imine.
| Compound Name | 3-[(4-fluorophenyl)sulfanylmethylidene]-4,4-dimethyl-N-(4-methylphenyl)oxolan-2-imine |
|---|---|
| PubChem CID | 77439569 |
| Molecular Formula | C20H20FNOS |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfanylmethylidene]-4,4-dimethyl-N-(4-methylphenyl)oxolan-2-imine |
| SMILES | Cc1ccc(/N=C2\OCC(C)(C)C2=CSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H20FNOS/c1-14-4-8-16(9-5-14)22-19-18(20(2,3)13-23-19)12-24-17-10-6-15(21)7-11-17/h4-12H,13H2,1-3H3/b18-12?,22-19- |
| InChIKey | FHKXNYKSCCUILQ-XRTGDFTJSA-N |
| XLogP | 5.90 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|