C19H18FNOS — CID 123810079
3-[(4-fluorophenyl)sulfanylmethylidene]-N-(4-methylphenyl)oxan-2-imine (PubChem CID 123810079) has the molecular formula C19H18FNOS and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfanylmethylidene]-N-(4-methylphenyl)oxan-2-imine.
| Compound Name | 3-[(4-fluorophenyl)sulfanylmethylidene]-N-(4-methylphenyl)oxan-2-imine |
|---|---|
| PubChem CID | 123810079 |
| Molecular Formula | C19H18FNOS |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfanylmethylidene]-N-(4-methylphenyl)oxan-2-imine |
| SMILES | Cc1ccc(/N=C2\OCCCC2=CSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H18FNOS/c1-14-4-8-17(9-5-14)21-19-15(3-2-12-22-19)13-23-18-10-6-16(20)7-11-18/h4-11,13H,2-3,12H2,1H3/b15-13?,21-19- |
| InChIKey | MLHAZVQPSSIOHS-FJSDNQNBSA-N |
| XLogP | 5.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|