C26H30FNOS — CID 140521515
[(2E)-3,7-dimethylocta-2,6-dienyl] 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidate (PubChem CID 140521515) has the molecular formula C26H30FNOS and a molecular weight of 423.60 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidate |
|---|---|
| PubChem CID | 140521515 |
| Molecular Formula | C26H30FNOS |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidate |
| SMILES | CC(C)=CCC/C(C)=C/CO/C(C=CSc1ccc(F)cc1)=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C26H30FNOS/c1-20(2)6-5-7-21(3)16-18-29-26(28-24-12-8-22(4)9-13-24)17-19-30-25-14-10-23(27)11-15-25/h6,8-17,19H,5,7,18H2,1-4H3/b19-17?,21-16+,28-26+ |
| InChIKey | XXXDGZWJWOGCCR-IYRGSFGMSA-N |
| XLogP | 8.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|