C17H19NO3S — CID 163770542
1,2,3-trimethoxy-4,8-dimethyl-3H-phenothiazine (PubChem CID 163770542) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1,2,3-trimethoxy-4,8-dimethyl-3H-phenothiazine.
| Compound Name | 1,2,3-trimethoxy-4,8-dimethyl-3H-phenothiazine |
|---|---|
| PubChem CID | 163770542 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1,2,3-trimethoxy-4,8-dimethyl-3H-phenothiazine |
| SMILES | COC1=C(OC)C(OC)C(C)=C2Sc3ccc(C)cc3N=C12 |
| InChI | InChI=1S/C17H19NO3S/c1-9-6-7-12-11(8-9)18-13-15(20-4)16(21-5)14(19-3)10(2)17(13)22-12/h6-8,14H,1-5H3 |
| InChIKey | MGAMPFYWNRIOJW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |