C24H20F3NS — CID 102042713
(Z)-1,1,1-trifluoro-4-(4-methylphenyl)-4-(4-methylphenyl)sulfanyl-N-phenylbut-3-en-2-imine (PubChem CID 102042713) has the molecular formula C24H20F3NS and a molecular weight of 411.49 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-(4-methylphenyl)-4-(4-methylphenyl)sulfanyl-N-phenylbut-3-en-2-imine.
| Compound Name | (Z)-1,1,1-trifluoro-4-(4-methylphenyl)-4-(4-methylphenyl)sulfanyl-N-phenylbut-3-en-2-imine |
|---|---|
| PubChem CID | 102042713 |
| Molecular Formula | C24H20F3NS |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-(4-methylphenyl)-4-(4-methylphenyl)sulfanyl-N-phenylbut-3-en-2-imine |
| SMILES | Cc1ccc(S/C(=C\C(=N\c2ccccc2)C(F)(F)F)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H20F3NS/c1-17-8-12-19(13-9-17)22(29-21-14-10-18(2)11-15-21)16-23(24(25,26)27)28-20-6-4-3-5-7-20/h3-16H,1-2H3/b22-16-,28-23- |
| InChIKey | NJQBSISBZTUGSL-QLCAPHDGSA-N |
| XLogP | 7.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|