C20H16FNS — CID 22031902
N-(2-fluoro-5-methylsulfanylphenyl)-1,1-diphenylmethanimine (PubChem CID 22031902) has the molecular formula C20H16FNS and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfanylphenyl)-1,1-diphenylmethanimine.
| Compound Name | N-(2-fluoro-5-methylsulfanylphenyl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 22031902 |
| Molecular Formula | C20H16FNS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(2-fluoro-5-methylsulfanylphenyl)-1,1-diphenylmethanimine |
| SMILES | CSc1ccc(F)c(N=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C20H16FNS/c1-23-17-12-13-18(21)19(14-17)22-20(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14H,1H3 |
| InChIKey | OJCGKVRHSYHDHW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|