C22H16F3NS2 — CID 59498028
phenyl (E)-4,4,4-trifluoro-N-phenyl-3-phenylsulfanylbut-2-enimidothioate (PubChem CID 59498028) has the molecular formula C22H16F3NS2 and a molecular weight of 415.51 g/mol. Its IUPAC name is phenyl (E)-4,4,4-trifluoro-N-phenyl-3-phenylsulfanylbut-2-enimidothioate.
| Compound Name | phenyl (E)-4,4,4-trifluoro-N-phenyl-3-phenylsulfanylbut-2-enimidothioate |
|---|---|
| PubChem CID | 59498028 |
| Molecular Formula | C22H16F3NS2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | phenyl (E)-4,4,4-trifluoro-N-phenyl-3-phenylsulfanylbut-2-enimidothioate |
| SMILES | FC(F)(F)/C(=C\C(=N\c1ccccc1)Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C22H16F3NS2/c23-22(24,25)20(27-18-12-6-2-7-13-18)16-21(26-17-10-4-1-5-11-17)28-19-14-8-3-9-15-19/h1-16H/b20-16+,26-21- |
| InChIKey | VDPYMYIANQHXMA-KRCLIWSJSA-N |
| XLogP | 7.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|