C22H26FNS2 — CID 58579775
4-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 58579775) has the molecular formula C22H26FNS2 and a molecular weight of 387.59 g/mol. Its IUPAC name is 4-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
| Compound Name | 4-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
|---|---|
| PubChem CID | 58579775 |
| Molecular Formula | C22H26FNS2 |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-methylhexan-3-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | CCC(C)C(CC)S/C(C=CSc1ccc(F)cc1)=N\c1ccccc1 |
| InChI | InChI=1S/C22H26FNS2/c1-4-17(3)21(5-2)26-22(24-19-9-7-6-8-10-19)15-16-25-20-13-11-18(23)12-14-20/h6-17,21H,4-5H2,1-3H3/b16-15?,24-22- |
| InChIKey | UEJMSYUCJARFFY-KVQNRFHPSA-N |
| XLogP | 7.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|