C19H26FNSSi — CID 58579761
cyclohexylmethyl N-(4-fluorophenyl)-3-trimethylsilylprop-2-ynimidothioate (PubChem CID 58579761) has the molecular formula C19H26FNSSi and a molecular weight of 347.58 g/mol. Its IUPAC name is cyclohexylmethyl N-(4-fluorophenyl)-3-trimethylsilylprop-2-ynimidothioate.
| Compound Name | cyclohexylmethyl N-(4-fluorophenyl)-3-trimethylsilylprop-2-ynimidothioate |
|---|---|
| PubChem CID | 58579761 |
| Molecular Formula | C19H26FNSSi |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | cyclohexylmethyl N-(4-fluorophenyl)-3-trimethylsilylprop-2-ynimidothioate |
| SMILES | C[Si](C)(C)C#C/C(=N/c1ccc(F)cc1)SCC1CCCCC1 |
| InChI | InChI=1S/C19H26FNSSi/c1-23(2,3)14-13-19(21-18-11-9-17(20)10-12-18)22-15-16-7-5-4-6-8-16/h9-12,16H,4-8,15H2,1-3H3/b21-19- |
| InChIKey | SSBICOKWEKNYBY-VZCXRCSSSA-N |
| XLogP | 6.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|