C22H24FNS2 — CID 58579783
(3-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 58579783) has the molecular formula C22H24FNS2 and a molecular weight of 385.57 g/mol. Its IUPAC name is (3-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
| Compound Name | (3-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
|---|---|
| PubChem CID | 58579783 |
| Molecular Formula | C22H24FNS2 |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (3-methylcyclohexyl) 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | CC1CCCC(S/C(C=CSc2ccc(F)cc2)=N/c2ccccc2)C1 |
| InChI | InChI=1S/C22H24FNS2/c1-17-6-5-9-21(16-17)26-22(24-19-7-3-2-4-8-19)14-15-25-20-12-10-18(23)11-13-20/h2-4,7-8,10-15,17,21H,5-6,9,16H2,1H3/b15-14?,24-22+ |
| InChIKey | CVEVETHWCIKSLY-LYFYZQSSSA-N |
| XLogP | 7.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|