C24H20FNS2 — CID 58579751
2,3-dihydro-1H-inden-2-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 58579751) has the molecular formula C24H20FNS2 and a molecular weight of 405.56 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate.
| Compound Name | 2,3-dihydro-1H-inden-2-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
|---|---|
| PubChem CID | 58579751 |
| Molecular Formula | C24H20FNS2 |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl 3-(4-fluorophenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | Fc1ccc(SC=C/C(=N\c2ccccc2)SC2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C24H20FNS2/c25-20-10-12-22(13-11-20)27-15-14-24(26-21-8-2-1-3-9-21)28-23-16-18-6-4-5-7-19(18)17-23/h1-15,23H,16-17H2/b15-14?,26-24+ |
| InChIKey | BAXFNMVFKPXAPW-XDZDESNCSA-N |
| XLogP | 7.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|