C22H23F2NS2 — CID 58579784
cyclohexylmethyl N-(3-fluorophenyl)-3-(4-fluorophenyl)sulfanylprop-2-enimidothioate (PubChem CID 58579784) has the molecular formula C22H23F2NS2 and a molecular weight of 403.56 g/mol. Its IUPAC name is cyclohexylmethyl N-(3-fluorophenyl)-3-(4-fluorophenyl)sulfanylprop-2-enimidothioate.
| Compound Name | cyclohexylmethyl N-(3-fluorophenyl)-3-(4-fluorophenyl)sulfanylprop-2-enimidothioate |
|---|---|
| PubChem CID | 58579784 |
| Molecular Formula | C22H23F2NS2 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | cyclohexylmethyl N-(3-fluorophenyl)-3-(4-fluorophenyl)sulfanylprop-2-enimidothioate |
| SMILES | Fc1ccc(SC=C/C(=N\c2cccc(F)c2)SCC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H23F2NS2/c23-18-9-11-21(12-10-18)26-14-13-22(25-20-8-4-7-19(24)15-20)27-16-17-5-2-1-3-6-17/h4,7-15,17H,1-3,5-6,16H2/b14-13?,25-22+ |
| InChIKey | ZWDBIZXWSQRABN-GLGZCROCSA-N |
| XLogP | 7.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|