C20H20F3NOS — CID 46932959
(Z)-6,6,6-trifluoro-2-methyl-3-(4-methylphenyl)sulfanyl-5-phenyliminohex-3-en-2-ol (PubChem CID 46932959) has the molecular formula C20H20F3NOS and a molecular weight of 379.45 g/mol. Its IUPAC name is (Z)-6,6,6-trifluoro-2-methyl-3-(4-methylphenyl)sulfanyl-5-phenyliminohex-3-en-2-ol.
| Compound Name | (Z)-6,6,6-trifluoro-2-methyl-3-(4-methylphenyl)sulfanyl-5-phenyliminohex-3-en-2-ol |
|---|---|
| PubChem CID | 46932959 |
| Molecular Formula | C20H20F3NOS |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (Z)-6,6,6-trifluoro-2-methyl-3-(4-methylphenyl)sulfanyl-5-phenyliminohex-3-en-2-ol |
| SMILES | Cc1ccc(S/C(=C\C(=N\c2ccccc2)C(F)(F)F)C(C)(C)O)cc1 |
| InChI | InChI=1S/C20H20F3NOS/c1-14-9-11-16(12-10-14)26-18(19(2,3)25)13-17(20(21,22)23)24-15-7-5-4-6-8-15/h4-13,25H,1-3H3/b18-13-,24-17- |
| InChIKey | WMOSNQGBOWAITE-KCZKKTIVSA-N |
| XLogP | 6.08 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|