C23H18F3NS — CID 102042712
(Z)-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-N,4-diphenylbut-3-en-2-imine (PubChem CID 102042712) has the molecular formula C23H18F3NS and a molecular weight of 397.47 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-N,4-diphenylbut-3-en-2-imine.
| Compound Name | (Z)-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-N,4-diphenylbut-3-en-2-imine |
|---|---|
| PubChem CID | 102042712 |
| Molecular Formula | C23H18F3NS |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-(4-methylphenyl)sulfanyl-N,4-diphenylbut-3-en-2-imine |
| SMILES | Cc1ccc(S/C(=C\C(=N\c2ccccc2)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18F3NS/c1-17-12-14-20(15-13-17)28-21(18-8-4-2-5-9-18)16-22(23(24,25)26)27-19-10-6-3-7-11-19/h2-16H,1H3/b21-16-,27-22- |
| InChIKey | DUNRUJHNEROZCB-GHLMXXQOSA-N |
| XLogP | 7.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|