C25H19ClF3NO2S — CID 46932956
ethyl (2E)-2-[(4-chlorophenyl)sulfanyl-phenylmethylidene]-4,4,4-trifluoro-3-phenyliminobutanoate (PubChem CID 46932956) has the molecular formula C25H19ClF3NO2S and a molecular weight of 489.95 g/mol. Its IUPAC name is ethyl (2E)-2-[(4-chlorophenyl)sulfanyl-phenylmethylidene]-4,4,4-trifluoro-3-phenyliminobutanoate.
| Compound Name | ethyl (2E)-2-[(4-chlorophenyl)sulfanyl-phenylmethylidene]-4,4,4-trifluoro-3-phenyliminobutanoate |
|---|---|
| PubChem CID | 46932956 |
| Molecular Formula | C25H19ClF3NO2S |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | ethyl (2E)-2-[(4-chlorophenyl)sulfanyl-phenylmethylidene]-4,4,4-trifluoro-3-phenyliminobutanoate |
| SMILES | CCOC(=O)C(/C(=N/c1ccccc1)C(F)(F)F)=C(/Sc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H19ClF3NO2S/c1-2-32-24(31)21(23(25(27,28)29)30-19-11-7-4-8-12-19)22(17-9-5-3-6-10-17)33-20-15-13-18(26)14-16-20/h3-16H,2H2,1H3/b22-21+,30-23- |
| InChIKey | RTMWIZFMCRUSFT-HXGSDDGASA-N |
| XLogP | 7.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|