C16H34N3O3P — CID 102043189
(E)-N-[bis(dimethylamino)phosphoryl]-N-methyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-1-en-1-amine (PubChem CID 102043189) has the molecular formula C16H34N3O3P and a molecular weight of 347.44 g/mol. Its IUPAC name is (E)-N-[bis(dimethylamino)phosphoryl]-N-methyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-1-en-1-amine.
| Compound Name | (E)-N-[bis(dimethylamino)phosphoryl]-N-methyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-1-en-1-amine |
|---|---|
| PubChem CID | 102043189 |
| Molecular Formula | C16H34N3O3P |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (E)-N-[bis(dimethylamino)phosphoryl]-N-methyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-1-en-1-amine |
| SMILES | CN(C)P(=O)(N(C)C)N(C)/C=C/CCCCCC1(C)OCCO1 |
| InChI | InChI=1S/C16H34N3O3P/c1-16(21-14-15-22-16)12-10-8-7-9-11-13-19(6)23(20,17(2)3)18(4)5/h11,13H,7-10,12,14-15H2,1-6H3/b13-11+ |
| InChIKey | CNKDFNTWRPGTFY-ACCUITESSA-N |
| XLogP | 3.38 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|