C28H28N4O2 — CID 10204393
methyl 3-[1-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]indazol-3-yl]benzoate (PubChem CID 10204393) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is methyl 3-[1-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]indazol-3-yl]benzoate.
| Compound Name | methyl 3-[1-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]indazol-3-yl]benzoate |
|---|---|
| PubChem CID | 10204393 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | methyl 3-[1-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]indazol-3-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2nn(Cc3nc4ccccc4n3CCC(C)C)c3ccccc23)c1 |
| InChI | InChI=1S/C28H28N4O2/c1-19(2)15-16-31-25-14-7-5-12-23(25)29-26(31)18-32-24-13-6-4-11-22(24)27(30-32)20-9-8-10-21(17-20)28(33)34-3/h4-14,17,19H,15-16,18H2,1-3H3 |
| InChIKey | IRGXRDIGJODBFV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |