C30H30N4O4 — CID 23517177
methyl 4-[[(Z)-[1-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxoindol-3-ylidene]amino]oxymethyl]benzoate (PubChem CID 23517177) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is methyl 4-[[(Z)-[1-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxoindol-3-ylidene]amino]oxymethyl]benzoate.
| Compound Name | methyl 4-[[(Z)-[1-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxoindol-3-ylidene]amino]oxymethyl]benzoate |
|---|---|
| PubChem CID | 23517177 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | methyl 4-[[(Z)-[1-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxoindol-3-ylidene]amino]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(CO/N=C2\C(=O)N(Cc3nc4ccccc4n3CCC(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H30N4O4/c1-20(2)16-17-33-26-11-7-5-9-24(26)31-27(33)18-34-25-10-6-4-8-23(25)28(29(34)35)32-38-19-21-12-14-22(15-13-21)30(36)37-3/h4-15,20H,16-19H2,1-3H3/b32-28- |
| InChIKey | HFLDGUVTJJPZRS-BLCKFSMSSA-N |
| XLogP | 5.34 |
| TPSA | 86.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|