C28H35FN6O4 — CID 87962639
tert-butyl N-[[2-[[(3Z)-3-(2-fluoroethoxyimino)-2-oxopyrrolo[2,3-b]pyridin-1-yl]methyl]-1-(3-methylbutyl)benzimidazol-5-yl]methyl]carbamate (PubChem CID 87962639) has the molecular formula C28H35FN6O4 and a molecular weight of 538.62 g/mol. Its IUPAC name is tert-butyl N-[[2-[[(3Z)-3-(2-fluoroethoxyimino)-2-oxopyrrolo[2,3-b]pyridin-1-yl]methyl]-1-(3-methylbutyl)benzimidazol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[[(3Z)-3-(2-fluoroethoxyimino)-2-oxopyrrolo[2,3-b]pyridin-1-yl]methyl]-1-(3-methylbutyl)benzimidazol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 87962639 |
| Molecular Formula | C28H35FN6O4 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | tert-butyl N-[[2-[[(3Z)-3-(2-fluoroethoxyimino)-2-oxopyrrolo[2,3-b]pyridin-1-yl]methyl]-1-(3-methylbutyl)benzimidazol-5-yl]methyl]carbamate |
| SMILES | CC(C)CCn1c(CN2C(=O)/C(=N\OCCF)c3cccnc32)nc2cc(CNC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C28H35FN6O4/c1-18(2)10-13-34-22-9-8-19(16-31-27(37)39-28(3,4)5)15-21(22)32-23(34)17-35-25-20(7-6-12-30-25)24(26(35)36)33-38-14-11-29/h6-9,12,15,18H,10-11,13-14,16-17H2,1-5H3,(H,31,37)/b33-24- |
| InChIKey | YWJSZDUGORQBIT-GIBOGKFOSA-N |
| XLogP | 4.74 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|