C21H21N5O3 — CID 142160012
4-[2-[(3-imino-2-oxopyrrolo[2,3-b]pyridin-1-yl)methyl]benzimidazol-1-yl]butyl acetate (PubChem CID 142160012) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 4-[2-[(3-imino-2-oxopyrrolo[2,3-b]pyridin-1-yl)methyl]benzimidazol-1-yl]butyl acetate.
| Compound Name | 4-[2-[(3-imino-2-oxopyrrolo[2,3-b]pyridin-1-yl)methyl]benzimidazol-1-yl]butyl acetate |
|---|---|
| PubChem CID | 142160012 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-[2-[(3-imino-2-oxopyrrolo[2,3-b]pyridin-1-yl)methyl]benzimidazol-1-yl]butyl acetate |
| SMILES | [H]/N=C1/C(=O)N(Cc2nc3ccccc3n2CCCCOC(C)=O)c2ncccc21 |
| InChI | InChI=1S/C21H21N5O3/c1-14(27)29-12-5-4-11-25-17-9-3-2-8-16(17)24-18(25)13-26-20-15(7-6-10-23-20)19(22)21(26)28/h2-3,6-10,22H,4-5,11-13H2,1H3/b22-19+ |
| InChIKey | BKJQYTVTNDIICU-ZBJSNUHESA-N |
| XLogP | 2.69 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|