C24H31N3O2 — CID 17006302
N-[[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]-2-methylpropanamide (PubChem CID 17006302) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]-2-methylpropanamide.
| Compound Name | N-[[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 17006302 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-[[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]-2-methylpropanamide |
| SMILES | Cc1cc(C)cc(OCCCCn2c(CNC(=O)C(C)C)nc3ccccc32)c1 |
| InChI | InChI=1S/C24H31N3O2/c1-17(2)24(28)25-16-23-26-21-9-5-6-10-22(21)27(23)11-7-8-12-29-20-14-18(3)13-19(4)15-20/h5-6,9-10,13-15,17H,7-8,11-12,16H2,1-4H3,(H,25,28) |
| InChIKey | XPPXQRFZTSOUOX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|