C28H31N3O3 — CID 17007684
N-[[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]-2-methoxybenzamide (PubChem CID 17007684) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17007684 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCc1nc2ccccc2n1CCCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C28H31N3O3/c1-20-16-21(2)18-22(17-20)34-15-9-8-14-31-25-12-6-5-11-24(25)30-27(31)19-29-28(32)23-10-4-7-13-26(23)33-3/h4-7,10-13,16-18H,8-9,14-15,19H2,1-3H3,(H,29,32) |
| InChIKey | KUDWQRQSEGGDPE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|