C26H26FN3O2 — CID 17007843
2-fluoro-N-[[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17007843) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-fluoro-N-[[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 2-fluoro-N-[[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17007843 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-fluoro-N-[[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | Cc1cccc(OCCCCn2c(CNC(=O)c3ccccc3F)nc3ccccc32)c1 |
| InChI | InChI=1S/C26H26FN3O2/c1-19-9-8-10-20(17-19)32-16-7-6-15-30-24-14-5-4-13-23(24)29-25(30)18-28-26(31)21-11-2-3-12-22(21)27/h2-5,8-14,17H,6-7,15-16,18H2,1H3,(H,28,31) |
| InChIKey | CXLCXGPSHZHAPI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|