C28H31N3O3 — CID 17007057
N-[[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]-2,4-dimethylbenzamide (PubChem CID 17007057) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]-2,4-dimethylbenzamide.
| Compound Name | N-[[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 17007057 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]-2,4-dimethylbenzamide |
| SMILES | COc1ccc(OCCCCn2c(CNC(=O)c3ccc(C)cc3C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C28H31N3O3/c1-20-10-15-24(21(2)18-20)28(32)29-19-27-30-25-8-4-5-9-26(25)31(27)16-6-7-17-34-23-13-11-22(33-3)12-14-23/h4-5,8-15,18H,6-7,16-17,19H2,1-3H3,(H,29,32) |
| InChIKey | TUBUVYJKNWNKSB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|