C28H31N3O2 — CID 17007029
N-[[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]methyl]-2,4-dimethylbenzamide (PubChem CID 17007029) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]methyl]-2,4-dimethylbenzamide.
| Compound Name | N-[[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]methyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 17007029 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]methyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2nc3ccccc3n2CCCOc2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C28H31N3O2/c1-19-10-13-24(22(4)16-19)28(32)29-18-27-30-25-8-5-6-9-26(25)31(27)14-7-15-33-23-12-11-20(2)21(3)17-23/h5-6,8-13,16-17H,7,14-15,18H2,1-4H3,(H,29,32) |
| InChIKey | IPGAFTABCAHFQB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|