C24H25N3O2S — CID 16973816
N-[[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]methyl]thiophene-2-carboxamide (PubChem CID 16973816) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16973816 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]methyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(OCCCn2c(CNC(=O)c3cccs3)nc3ccccc32)cc1C |
| InChI | InChI=1S/C24H25N3O2S/c1-17-10-11-19(15-18(17)2)29-13-6-12-27-21-8-4-3-7-20(21)26-23(27)16-25-24(28)22-9-5-14-30-22/h3-5,7-11,14-15H,6,12-13,16H2,1-2H3,(H,25,28) |
| InChIKey | KSOZQDIKLJCHNM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|