C40H35N5O4 — CID 74058206
4-[2-[(2-oxo-3-trityloxyiminopyrrolo[2,3-b]pyridin-1-yl)methyl]benzimidazol-1-yl]butyl acetate (PubChem CID 74058206) has the molecular formula C40H35N5O4 and a molecular weight of 649.75 g/mol. Its IUPAC name is 4-[2-[(2-oxo-3-trityloxyiminopyrrolo[2,3-b]pyridin-1-yl)methyl]benzimidazol-1-yl]butyl acetate.
| Compound Name | 4-[2-[(2-oxo-3-trityloxyiminopyrrolo[2,3-b]pyridin-1-yl)methyl]benzimidazol-1-yl]butyl acetate |
|---|---|
| PubChem CID | 74058206 |
| Molecular Formula | C40H35N5O4 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 4-[2-[(2-oxo-3-trityloxyiminopyrrolo[2,3-b]pyridin-1-yl)methyl]benzimidazol-1-yl]butyl acetate |
| SMILES | CC(=O)OCCCCn1c(CN2C(=O)C(=NOC(c3ccccc3)(c3ccccc3)c3ccccc3)c3cccnc32)nc2ccccc21 |
| InChI | InChI=1S/C40H35N5O4/c1-29(46)48-27-14-13-26-44-35-24-12-11-23-34(35)42-36(44)28-45-38-33(22-15-25-41-38)37(39(45)47)43-49-40(30-16-5-2-6-17-30,31-18-7-3-8-19-31)32-20-9-4-10-21-32/h2-12,15-25H,13-14,26-28H2,1H3 |
| InChIKey | FQINZRQXMYRBQW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 98.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|